What is the molecular formula of Cylindrin?
The molecular formula of Cylindrin is C31H52O.
What are the synonyms for Cylindrin?
The synonyms for Cylindrin include (3S,3aS,5aS,5bS,7aR,9S,11aS,13aR,13bS)-9-methoxy-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysene, SCHEMBL3679265, CHEBI:81166, and more.
What is the molecular weight of Cylindrin?
The molecular weight of Cylindrin is 440.7 g/mol.
Is Cylindrin a natural product?
Yes, Cylindrin is a natural product found in Diospyros nigra, Diospyros blancoi, and other organisms.
What is the IUPAC name of Cylindrin?
The IUPAC name of Cylindrin is (3S,3aS,5aS,5bS,7aR,9S,11aS,13aR,13bS)-9-methoxy-3a,5a,8,8,11a,13a-hexamethyl-3-propan-2-yl-1,2,3,4,5,5b,6,7,7a,9,10,11,13,13b-tetradecahydrocyclopenta[a]chrysene.
What is the InChI of Cylindrin?
The InChI of Cylindrin is InChI=1S/C31H52O/c1-20(2)21-10-13-25-29(21,6)18-19-30(7)23-11-12-24-27(3,4)26(32-9)15-16-28(24,5)22(23)14-17-31(25,30)8/h14,20-21,23-26H,10-13,15-19H2,1-9H3/t21-,23+,24-,25-,26-,28+,29-,30-,31+/m0/s1.
What is the InChIKey of Cylindrin?
The InChIKey of Cylindrin is MRNPHCMRIQYRFU-UWAWSDATSA-N.
What is the canonical SMILES of Cylindrin?
The canonical SMILES of Cylindrin is CC(C)C1CCC2C1(CCC3(C2(CC=C4C3CCC5C4(CCC(C5(C)C)OC)C)C)C)C.
What is the CAS number of Cylindrin?
The CAS number of Cylindrin is 17904-55-1.
What is the molecular weight of Cylindrin according to PubChem?
The molecular weight of Cylindrin is 440.7 g/mol, computed by PubChem 2.1.