What is the molecular formula of Cyclobutyl-acetic acid?
The molecular formula of Cyclobutyl-acetic acid is C6H10O2.
What are the synonyms of Cyclobutyl-acetic acid?
The synonyms of Cyclobutyl-acetic acid include 2-cyclobutylacetic Acid, 6540-33-6, cyclobutylacetic acid, Cyclobutaneacetic acid, and more.
What is the molecular weight of Cyclobutyl-acetic acid?
The molecular weight of Cyclobutyl-acetic acid is 114.14 g/mol.
What is the IUPAC name of Cyclobutyl-acetic acid?
The IUPAC name of Cyclobutyl-acetic acid is 2-cyclobutylacetic acid.
What is the InChI of Cyclobutyl-acetic acid?
The InChI of Cyclobutyl-acetic acid is InChI=1S/C6H10O2/c7-6(8)4-5-2-1-3-5/h5H,1-4H2,(H,7,8).
What is the InChIKey of Cyclobutyl-acetic acid?
The InChIKey of Cyclobutyl-acetic acid is FQRMJJJRCOMBKG-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclobutyl-acetic acid?
The canonical SMILES of Cyclobutyl-acetic acid is C1CC(C1)CC(=O)O.
What is the CAS number of Cyclobutyl-acetic acid?
The CAS number of Cyclobutyl-acetic acid is 6540-33-6.
Is Cyclobutyl-acetic acid a canonicalized compound?
Yes, Cyclobutyl-acetic acid is a canonicalized compound according to PubChem.