Cyclobenzaprine hcl

CAS

303-53-7

Catalog Number

ACM303537

Category

Other Products

Molecular Weight

311.85

Molecular Formula

C₂₀H₂₂ClN

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

CYCLOBENZAPRINE;CYCLOBENZAPRINE HCL;10,11-dehydroamitriptyline;1-Propanamine, 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-;3-(5h-dibenzo(a,d)cyclohepten-5-ylidene)-n,n-dimethyl-1-propanamin;3-(5H-Dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethyl-1-propanamine;5-(3-Dimetilaminopropiliden)-5H-dibenzo-(a,d)-ciclopentene;5H-Dibenzo(a,d)cycloheptene-delta5,gamma-propylamine, N,N-dimethyl-

What is the molecular formula of Cyclobenzaprine hydrochloride?

The molecular formula of Cyclobenzaprine hydrochloride is C20H22ClN.

What is the molecular weight of Cyclobenzaprine hydrochloride?

The molecular weight of Cyclobenzaprine hydrochloride is 311.8 g/mol.

What is the IUPAC Name of Cyclobenzaprine hydrochloride?

The IUPAC Name of Cyclobenzaprine hydrochloride is N,N-dimethyl-3-(2-tricyclo[9.4.0.0 3,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)propan-1-amine;hydrochloride.

What is the InChIKey of Cyclobenzaprine hydrochloride?

The InChIKey of Cyclobenzaprine hydrochloride is VXEAYBOGHINOKW-UHFFFAOYSA-N.

What is the Canonical SMILES of Cyclobenzaprine hydrochloride?

The Canonical SMILES of Cyclobenzaprine hydrochloride is CN(C)CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31.Cl.

What is the CAS number of Cyclobenzaprine hydrochloride?

The CAS number of Cyclobenzaprine hydrochloride is 6202-23-9.

How does Cyclobenzaprine hydrochloride primarily act in the body?

Cyclobenzaprine hydrochloride primarily acts at the brain stem to reduce tonic somatic motor activity, influencing both gamma and alpha motor neurons, leading to a reduction in muscle spasms.

What is the role of Cyclobenzaprine hydrochloride?

Cyclobenzaprine hydrochloride is used as a centrally acting skeletal muscle relaxant in the symptomatic treatment of painful muscle spasm. It also has a role as a muscle relaxant and an antidepressant.

What are the synonyms of Cyclobenzaprine hydrochloride?

Some synonyms of Cyclobenzaprine hydrochloride include Flexeril, Flexiban, and Cyclobenzaprine HCL.

What is the Parent Compound of Cyclobenzaprine hydrochloride?

The Parent Compound of Cyclobenzaprine hydrochloride is Cyclobenzaprine (CID 2895).