What is the molecular formula of crystal violet lactone?
The molecular formula of crystal violet lactone is C26H29N3O2.
What are the synonyms of crystal violet lactone?
The synonyms of crystal violet lactone are 3,3-Bis(p-dimethylaminophenyl)-6-dimethylaminophthalide, 3,3-Bis(4-dimethylaminophenyl)-6-dimethylaminophthalide, 3,3-Bis(p-dimethylaminophenyl)-6-dimethylaminophthalate.
What is the molecular weight of crystal violet lactone?
The molecular weight of crystal violet lactone is 415.5 g/mol.
What is the description of crystal violet lactone?
Crystal violet lactone appears as blue-green crystals or pale green powder.
What is crystal violet lactone classified as?
Crystal violet lactone is classified as a member of benzofurans.
What is the IUPAC name of crystal violet lactone?
The IUPAC name of crystal violet lactone is 6-(dimethylamino)-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one.
What is the InChI of crystal violet lactone?
The InChI of crystal violet lactone is InChI=1S/C26H29N3O2/c1-27(2)20-11-7-18(8-12-20)26(19-9-13-21(14-10-19)28(3)4)24-16-15-22(29(5)6)17-23(24)25(30)31-26/h7-17H,1-6H3.
What is the InChIKey of crystal violet lactone?
The InChIKey of crystal violet lactone is IPAJDLMMTVZVPP-UHFFFAOYSA-N.
What is the CAS number of crystal violet lactone?
The CAS number of crystal violet lactone is 1552-42-7.
What is the XLogP3 value of crystal violet lactone?
The XLogP3 value of crystal violet lactone is 5.3.