What is the molecular formula of Collismycin?
The molecular formula of Collismycin is C13H13N3O2S.
What are the synonyms of Collismycin?
The synonyms of Collismycin are Collismycin B and (NZ)-N-[(4-methoxy-3-methylsulfanyl-6-pyridin-2-ylpyridin-2-yl)methylidene]hydroxylamine.
What is the molecular weight of Collismycin?
The molecular weight of Collismycin is 275.33 g/mol.
When was Collismycin created and modified?
Collismycin was created on January 15, 2019, and last modified on October 21, 2023.
What is the structure of Collismycin?
The structure of Collismycin can be viewed at the following link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=135474257&t=l
What is the IUPAC name of Collismycin?
The IUPAC name of Collismycin is (NZ)-N-[(4-methoxy-3-methylsulfanyl-6-pyridin-2-ylpyridin-2-yl)methylidene]hydroxylamine.
What is the InChI of Collismycin?
The InChI of Collismycin is InChI=1S/C13H13N3O2S/c1-18-12-7-10(9-5-3-4-6-14-9)16-11(8-15-17)13(12)19-2/h3-8,17H,1-2H3/b15-8-.
What is the InChIKey of Collismycin?
The InChIKey of Collismycin is NQGMIPUYCWIEAW-NVNXTCNLSA-N.
What is the Canonical SMILES of Collismycin?
The Canonical SMILES of Collismycin is COC1=CC(=NC(=C1SC)C=NO)C2=CC=CC=N2.
What is the CAS number of Collismycin?
The CAS number of Collismycin is 158792-25-7.