What is the IUPAC name of the Ck2 inhibitor ii?
The IUPAC name of the Ck2 inhibitor ii is 4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine.
What is the InChI of the Ck2 inhibitor ii?
The InChI of the Ck2 inhibitor ii is InChI=1S/C9H7Br4N3/c1-16(2)9-14-7-5(12)3(10)4(11)6(13)8(7)15-9/h1-2H3,(H,14,15).
What is the InChIKey of the Ck2 inhibitor ii?
The InChIKey of the Ck2 inhibitor ii is SLPJGDQJLTYWCI-UHFFFAOYSA-N.
What is the molecular weight of the Ck2 inhibitor ii?
The molecular weight of the Ck2 inhibitor ii is 476.79 g/mol.
What is the CAS number of the Ck2 inhibitor ii?
The CAS number of the Ck2 inhibitor ii is 749234-11-5.
What is the EC number of the Ck2 inhibitor ii?
The EC number of the Ck2 inhibitor ii is 636-153-0.
What is the ChEMBL ID of the Ck2 inhibitor ii?
The ChEMBL ID of the Ck2 inhibitor ii is CHEMBL376505.
What is the DSSTox Substance ID of the Ck2 inhibitor ii?
The DSSTox Substance ID of the Ck2 inhibitor ii is DTXSID70416119.
What is the XLogP3-AA value of the Ck2 inhibitor ii?
The XLogP3-AA value of the Ck2 inhibitor ii is 4.7.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.