What is the molecular formula of cis-2-Iodovinylboronic acid MIDA ester?
The molecular formula of cis-2-Iodovinylboronic acid MIDA ester is C7H9BINO4.
What are the synonyms for cis-2-Iodovinylboronic acid MIDA ester?
The synonyms for cis-2-Iodovinylboronic acid MIDA ester are ZB0275, 1260506-59-9, A51263, and (Z)-2-(2-iodovinyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
What is the molecular weight of cis-2-Iodovinylboronic acid MIDA ester?
The molecular weight of cis-2-Iodovinylboronic acid MIDA ester is 308.87 g/mol.
What is the IUPAC name of cis-2-Iodovinylboronic acid MIDA ester?
The IUPAC name of cis-2-Iodovinylboronic acid MIDA ester is 2-[(Z)-2-iodoethenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
What is the InChI of cis-2-Iodovinylboronic acid MIDA ester?
The InChI of cis-2-Iodovinylboronic acid MIDA ester is InChI=1S/C7H9BINO4/c1-10-4-6(11)13-8(2-3-9)14-7(12)5-10/h2-3H,4-5H2,1H3/b3-2-.
What is the InChIKey of cis-2-Iodovinylboronic acid MIDA ester?
The InChIKey of cis-2-Iodovinylboronic acid MIDA ester is DVVPFXIZOZTSBN-IHWYPQMZSA-N.
What is the canonical SMILES of cis-2-Iodovinylboronic acid MIDA ester?
The canonical SMILES of cis-2-Iodovinylboronic acid MIDA ester is B1(OC(=O)CN(CC(=O)O1)C)C=CI.
What is the isomeric SMILES of cis-2-Iodovinylboronic acid MIDA ester?
The isomeric SMILES of cis-2-Iodovinylboronic acid MIDA ester is B1(OC(=O)CN(CC(=O)O1)C)/C=C\I.
What is the Nikkaji Number of cis-2-Iodovinylboronic acid MIDA ester?
The Nikkaji Number of cis-2-Iodovinylboronic acid MIDA ester is J3.124.268A.
What is the topological polar surface area of cis-2-Iodovinylboronic acid MIDA ester?
The topological polar surface area of cis-2-Iodovinylboronic acid MIDA ester is 55.8Ų.
※ Please kindly note that our products are for research use only.