What is the PubChem CID of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The PubChem CID of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is 2734695.
What is the molecular formula of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The molecular formula of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is C7H12ClNO2.
What is the molecular weight of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The molecular weight of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is 177.63 g/mol.
What are the synonyms of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The synonyms of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride are 131783-54-5, 142035-00-5, CIS-2-AMINO-CYCLOHEX-3-ENECARBOXYLIC ACID HYDROCHLORIDE, (1R,2S)-(+)-2-AMINOCYCLOHEX-3-ENECARBOXYLIC ACID hydrochloride, and (1R,2S)-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride.
What is the IUPAC name of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The IUPAC name of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is (1R,2S)-2-aminocyclohex-3-ene-1-carboxylic acid; hydrochloride
What is the InChI of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The InChI of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is InChI=1S/C7H11NO2.ClH/c8-6-4-2-1-3-5(6)7(9)10;/h2,4-6H,1,3,8H2,(H,9,10);1H/t5-,6+;/m1./s1.
What is the Canonical SMILES of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The Canonical SMILES of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is C1CC(C(C=C1)N)C(=O)O.Cl.
What is the CAS number of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The CAS number of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is 142035-00-5.
What is the European Community (EC) number of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride?
The European Community (EC) number of cis-2-Amino-cyclohex-3-enecarboxylic acid hydrochloride is 635-074-9.
※ Please kindly note that our products are for research use only.