What is the PubChem CID for cilnidipine?
PubChem CID 5282138 is the reference number for cilnidipine.
What is the molecular formula of cilnidipine?
The molecular formula of cilnidipine is C27H28N2O7.
What is the molecular weight of cilnidipine?
The molecular weight of cilnidipine is 492.5 g/mol.
What is the IUPAC name of cilnidipine?
The IUPAC name of cilnidipine is 3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
What is the InChIKey of cilnidipine?
The InChIKey of cilnidipine is KJEBULYHNRNJTE-DHZHZOJOSA-N.
What is the canonical SMILES of cilnidipine?
The canonical SMILES of cilnidipine is CC1=C(C(C(=C(N1)C)C(=O)OCC=CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC.
What is the CAS number of cilnidipine?
The CAS number of cilnidipine is 132203-70-4.
Is cilnidipine approved in China?
Yes, cilnidipine is approved in China.
What is the ChEMBL ID for cilnidipine?
The ChEMBL ID for cilnidipine is CHEMBL452076.
What is the XLogP3 value of cilnidipine?
The XLogP3 value of cilnidipine is 4.4.