What is the PubChem CID for Chloromethyl acetate?
PubChem CID 69366.
What is the molecular formula of Chloromethyl acetate?
The molecular formula is C3H5ClO2.
What is the molecular weight of Chloromethyl acetate?
The molecular weight is 108.52 g/mol.
What is the IUPAC name of Chloromethyl acetate?
The IUPAC name is chloromethyl acetate.
What is the InChI of Chloromethyl acetate?
The InChI is InChI=1S/C3H5ClO2/c1-3(5)6-2-4/h2H2,1H3.
What is the InChIKey of Chloromethyl acetate?
The InChIKey is SMJYMSAPPGLBAR-UHFFFAOYSA-N.
What is the canonical SMILES of Chloromethyl acetate?
The canonical SMILES is CC(=O)OCCl.
What is the CAS number of Chloromethyl acetate?
The CAS number is 625-56-9.
What is the European Community (EC) Number of Chloromethyl acetate?
The EC number is 210-902-8.
What is the formal charge of Chloromethyl acetate?
The formal charge is 0.