What is the molecular formula of cesium propionate?
The molecular formula of cesium propionate is C3H5CsO2.
What is the molecular weight of cesium propionate?
The molecular weight of cesium propionate is 205.98 g/mol.
What is the IUPAC name of cesium propionate?
The IUPAC name of cesium propionate is cesium;propanoate.
What is the InChI of cesium propionate?
The InChI of cesium propionate is InChI=1S/C3H6O2.Cs/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1.
What is the InChIKey of cesium propionate?
The InChIKey of cesium propionate is YBZSHUAKOJGWRT-UHFFFAOYSA-M.
What is the canonical SMILES of cesium propionate?
The canonical SMILES of cesium propionate is CCC(=O)[O-].[Cs+].
What is the CAS number of cesium propionate?
The CAS number of cesium propionate is 38869-24-8.
How many heavy atoms are present in cesium propionate?
There are 6 heavy atoms present in cesium propionate.
Does cesium propionate have any defined atom stereocenter count?
No, cesium propionate does not have any defined atom stereocenter count.