What is the molecular formula of Bismuth(III) molybdate?
The molecular formula of Bismuth(III) molybdate is Bi2(MoO4)3.
What is the molecular weight of Bismuth(III) molybdate?
The molecular weight of Bismuth(III) molybdate is 897.8 g/mol.
What is the IUPAC name of Bismuth(III) molybdate?
The IUPAC name of Bismuth(III) molybdate is bis[(dioxo(oxobismuthanyloxy)molybdenio)oxy]-dioxomolybdenum.
What is the InChI of Bismuth(III) molybdate?
The InChI of Bismuth(III) molybdate is InChI=1S/2Bi.3Mo.12O.
What is the InChIkey of Bismuth(III) molybdate?
The InChIkey of Bismuth(III) molybdate is NJCRYJVCAARZQB-UHFFFAOYSA-N.
What is the canonical SMILES of Bismuth(III) molybdate?
The canonical SMILES of Bismuth(III) molybdate is O=[Mo](=O)(O[Mo](=O)(=O)O[Bi]=O)O[Mo](=O)(=O)O[Bi]=O.
What is the synonyms of Bismuth(III) molybdate?
The synonyms of Bismuth(III) molybdate are Bismuth(III) molybdate, 99.9% and AKOS015912031.
What is the hydrogen bond donor count of Bismuth(III) molybdate?
The hydrogen bond donor count of Bismuth(III) molybdate is 0.
What is the hydrogen bond acceptor count of Bismuth(III) molybdate?
The hydrogen bond acceptor count of Bismuth(III) molybdate is 12.
Is Bismuth(III) molybdate a canonicalized compound?
Yes, Bismuth(III) molybdate is a canonicalized compound.
Download
