What is the PubChem CID of o,o-Diethyl thiophosphonate?
The PubChem CID of o,o-Diethyl thiophosphonate is 6328650.
What is the molecular formula of o,o-Diethyl thiophosphonate?
The molecular formula of o,o-Diethyl thiophosphonate is C4H10O2PS+.
What are the synonyms of o,o-Diethyl thiophosphonate?
The synonyms of o,o-Diethyl thiophosphonate are O,O-Diethyl phosphonothioate, Phosphonothioic acid, O,O-diethyl ester, O,O-Diethyl thiophosphonate, and 999-01-9 diethyl thiophosphite.
What is the molecular weight of o,o-Diethyl thiophosphonate?
The molecular weight of o,o-Diethyl thiophosphonate is 153.16 g/mol.
What is the IUPAC name of o,o-Diethyl thiophosphonate?
The IUPAC name of o,o-Diethyl thiophosphonate is diethoxy(sulfanylidene)phosphanium.
What is the InChI of o,o-Diethyl thiophosphonate?
The InChI of o,o-Diethyl thiophosphonate is InChI=1S/C4H10O2PS/c1-3-5-7(8)6-4-2/h3-4H2,1-2H3/q+1.
What is the InChIKey of o,o-Diethyl thiophosphonate?
The InChIKey of o,o-Diethyl thiophosphonate is RJODUASCKGDMQK-UHFFFAOYSA-N.
What is the canonical SMILES of o,o-Diethyl thiophosphonate?
The canonical SMILES of o,o-Diethyl thiophosphonate is CCO[P+](=S)OCC.
What is the CAS number of o,o-Diethyl thiophosphonate?
The CAS number of o,o-Diethyl thiophosphonate is 999-01-9.
Is o,o-Diethyl thiophosphonate a canonicalized compound?
Yes, o,o-Diethyl thiophosphonate is a canonicalized compound.
※ Please kindly note that our products are for research use only.
Download
![2,2-Dimethyl-5-vinyl-[1,3]dioxolane-4-carboxylic acid](https://resource.alfa-chemistry.com/structure/99902-66-6.gif)
