What is the PubChem CID of (+)-Valencene?
The PubChem CID of (+)-Valencene is 9855795.
What is the molecular formula of (+)-Valencene?
The molecular formula of (+)-Valencene is C15H24.
What is the molecular weight of (+)-Valencene?
The molecular weight of (+)-Valencene is 204.35 g/mol.
What is the IUPAC name of (+)-Valencene?
The IUPAC name of (+)-Valencene is (3R,4aS,5R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
What is the InChI of (+)-Valencene?
The InChI of (+)-Valencene is InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1.
What is the InChIKey of (+)-Valencene?
The InChIKey of (+)-Valencene is QEBNYNLSCGVZOH-NFAWXSAZSA-N.
What is the canonical SMILES of (+)-Valencene?
The canonical SMILES of (+)-Valencene is CC1CCC=C2C1(CC(CC2)C(=C)C)C.
What is the CAS number of (+)-Valencene?
The CAS number of (+)-Valencene is 4630-07-3.
What is the FEMA number of (+)-Valencene?
The FEMA number of (+)-Valencene is 3443.
What is the ChEMBL ID of (+)-Valencene?
The ChEMBL ID of (+)-Valencene is CHEMBL3186909.