What is the molecular formula of Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The molecular formula is C11H24NaO9P.
What is the molecular weight of Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The molecular weight is 354.27 g/mol.
When was Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate created?
It was created on 2009-08-20.
What are synonyms for Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
Some synonyms include EINECS 309-009-7, 99688-43-4, and DTXSID30912546.
What are the component compounds of Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The component compounds are Sodium and 2-[2-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl dihydrogen phosphate.
What is the IUPAC name for Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The IUPAC name is sodium;2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl hydrogen phosphate.
What is the Canonical SMILES notation for Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The Canonical SMILES is COCCOCCOCCOCCOCCOP(=O)(O)[O-].[Na+].
What is the InChIKey for Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The InChIKey is AQCLCQSSUNCAHX-UHFFFAOYSA-M.
What is the exact mass of Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
The exact mass is 354.10556362 g/mol.
How many hydrogen bond acceptors are in Sodium 2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate?
There are 9 hydrogen bond acceptors.