What is the molecular formula of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The molecular formula is C16H22O10.
What is the IUPAC Name of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The IUPAC Name is pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate.
What is the molecular weight of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The molecular weight is 374.34 g/mol.
What is the InChI of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The InChI is InChI=1S/C16H22O10/c1-22-10(17)9-6-15(11(18)23-2,12(19)24-3)8-16(7-9,13(20)25-4)14(21)26-5/h9H,6-8H2,1-5H3.
What is the InChIKey of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The InChIKey is JSIMVXDUJAWHOE-UHFFFAOYSA-N.
What is the Canonical SMILES of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The Canonical SMILES is COC(=O)C1CC(CC(C1)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC.
What is the XLogP3-AA value of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The XLogP3-AA value is 0.5.
How many hydrogen bond acceptors are present in Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
There are 10 hydrogen bond acceptors.
What is the topological polar surface area of Pentamethyl cyclohexane-1,1,3,3,5-pentacarboxylate?
The topological polar surface area is 132 Ų.
Is the compound Canonicalized according to PubChem?
Yes, the compound is Canonicalized according to PubChem.