What is the molecular formula of Flecainide?
The molecular formula of Flecainide is C17H20F6N2O3.
When was Flecainide first synthesized?
Flecainide was first synthesized in 1972.
What is the primary use of Flecainide?
Flecainide is used as an antiarrhythmic agent to prevent and treat abnormal fast heart rhythms.
What is the FDA approval date for Flecainide?
Flecainide was granted FDA approval on October 31, 1985.
What is the IUPAC name of Flecainide?
The IUPAC name of Flecainide is N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
What is the InChIKey for Flecainide?
The InChIKey for Flecainide is DJBNUMBKLMJRSA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Flecainide?
The Canonical SMILES representation of Flecainide is C1CCNC(C1)CNC(=O)C2=C(C=CC(=C2)OCC(F)(F)F)OCC(F)(F)F.
What is the CAS number for Flecainide?
The CAS number for Flecainide is 54143-55-4.
What is the molecular weight of Flecainide?
The molecular weight of Flecainide is 414.34 g/mol.
What is the role of Flecainide as?
Flecainide has a role as an anti-arrhythmic drug.