What is the molecular formula of N-Desmethylcarboxy terbinafine?
The molecular formula of N-Desmethylcarboxy terbinafine is C20H21NO2.
What is the computed IUPAC name of N-Desmethylcarboxy terbinafine?
The computed IUPAC name of N-Desmethylcarboxy terbinafine is (E)-2,2-dimethyl-7-(naphthalen-1-ylmethylamino)hept-5-en-3-ynoic acid.
What is the InChI of N-Desmethylcarboxy terbinafine?
The InChI of N-Desmethylcarboxy terbinafine is InChI=1S/C20H21NO2/c1-20(2,19(22)23)13-6-3-7-14-21-15-17-11-8-10-16-9-4-5-12-18(16)17/h3-5,7-12,21H,14-15H2,1-2H3,(H,22,23)/b7-3+.
What is the InChIKey of N-Desmethylcarboxy terbinafine?
The InChIKey of N-Desmethylcarboxy terbinafine is HLMXKUJHRUTHIL-XVNBXDOJSA-N.
What is the canonical SMILES of N-Desmethylcarboxy terbinafine?
The canonical SMILES of N-Desmethylcarboxy terbinafine is CC(C)(C#CC=CCNCC1=CC=CC2=CC=CC=C21)C(=O)O.
What is the isomeric SMILES of N-Desmethylcarboxy terbinafine?
The isomeric SMILES of N-Desmethylcarboxy terbinafine is CC(C)(C#C/C=C/CNCC1=CC=CC2=CC=CC=C21)C(=O)O.
What is the CAS number of N-Desmethylcarboxy terbinafine?
The CAS number of N-Desmethylcarboxy terbinafine is 99473-15-1.
What is the molecular weight of N-Desmethylcarboxy terbinafine?
The molecular weight of N-Desmethylcarboxy terbinafine is 307.4 g/mol.
How many hydrogen bond donor counts does N-Desmethylcarboxy terbinafine have?
N-Desmethylcarboxy terbinafine has 2 hydrogen bond donor counts.
How many rotatable bond counts does N-Desmethylcarboxy terbinafine have?
N-Desmethylcarboxy terbinafine has 6 rotatable bond counts.
※ Please kindly note that our products are for research use only.