What is the molecular formula of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The molecular formula is C10H14FNO2.
What is the IUPAC name of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The IUPAC name is 2-(2-fluoro-4,5-dimethoxyphenyl)ethanamine.
What is the InChI of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The InChI is InChI=1S/C10H14FNO2/c1-13-9-5-7(3-4-12)8(11)6-10(9)14-2/h5-6H,3-4,12H2,1-2H3.
What is the InChIKey of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The InChIKey is ITGAJFDPLNWOGD-UHFFFAOYSA-N.
What is the canonical SMILES of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The canonical SMILES is COC1=C(C=C(C(=C1)CCN)F)OC.
What is the molecular weight of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The molecular weight is 199.22 g/mol.
What is the XLogP3-AA value of 3,4-Dimethoxy-6-fluoro-phenylethylamine?
The XLogP3-AA value is 1.3.
How many hydrogen bond donor counts are there in 3,4-Dimethoxy-6-fluoro-phenylethylamine?
There is 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in 3,4-Dimethoxy-6-fluoro-phenylethylamine?
There are 4 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 3,4-Dimethoxy-6-fluoro-phenylethylamine?
There are 4 rotatable bond counts.