CAS
99395-88-7 Purity
>99.0%(GC)
99395-88-7 Purity
>99.0%(GC)
Shopping basket
Spirocardin b
CAS
99401-77-1
Catalog Number
ACM99401771
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Spirocardin B?
The molecular formula of Spirocardin B is C20H32O6.
When was Spirocardin B created and modified?
Spirocardin B was created on 2005-08-08 and last modified on 2023-12-30.
What is the computed IUPAC name of Spirocardin B?
The computed IUPAC name of Spirocardin B is 4-[2-[2-(1,2-dihydroxyethyl)oxiran-2-yl]-2-hydroxyethyl]-2-hydroxy-3,4,8,8a-tetramethyl-3,4a,5,6-tetrahydro-2H-naphthalen-1-one.
What is the InChI key of Spirocardin B?
The InChI key of Spirocardin B is PDPQILPMCDOHDB-UHFFFAOYSA-N.
What is the canonical SMILES representation of Spirocardin B?
The canonical SMILES representation of Spirocardin B is CC1C(C(=O)C2(C(C1(C)CC(C3(CO3)C(CO)O)O)CCC=C2C)C)O.
What is the molecular weight of Spirocardin B?
The molecular weight of Spirocardin B is 368.5 g/mol.
How many hydrogen bond donor counts are there in Spirocardin B?
There are 4 hydrogen bond donor counts in Spirocardin B.
How many rotatable bond counts are there in Spirocardin B?
There are 5 rotatable bond counts in Spirocardin B.
What is the topological polar surface area of Spirocardin B?
The topological polar surface area of Spirocardin B is 111 Å2.
Is Spirocardin B a canonicalized compound?
Yes, Spirocardin B is a canonicalized compound according to PubChem.
Please kindly note that our products are for research use only.
Recommended Products
