What is the molecular formula of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The molecular formula is C10H8N2O3S.
What is the molecular weight of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The molecular weight is 236.25 g/mol.
What is the IUPAC Name of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The IUPAC Name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid.
What is the InChI of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The InChI is InChI=1S/C10H8N2O3S/c13-8(14)6-16-10-12-11-9(15-10)7-4-2-1-3-5-7/h1-5H,6H2,(H,13,14).
What is the InChIKey of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The InChIKey is VKPCKQCSWWCRFI-UHFFFAOYSA-N.
How many hydrogen bond donor counts does (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid have?
It has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid?
The topological polar surface area is 102 Ų.
How many rotatable bond counts does (5-Phenyl-[1,3,4]oxadiazol-2-ylsulfanyl)acetic acid have?
It has 4 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.