What is the molecular formula of Hydroxy Torsemide?
The molecular formula of Hydroxy Torsemide is C16H20N4O4S.
What is the molecular weight of Hydroxy Torsemide?
The molecular weight of Hydroxy Torsemide is 364.4 g/mol.
What is the IUPAC name of Hydroxy Torsemide?
The IUPAC name of Hydroxy Torsemide is 1-[4-[3-(hydroxymethyl)anilino]pyridin-3-yl]sulfonyl-3-propan-2-ylurea.
What is the canonical SMILES representation of Hydroxy Torsemide?
The canonical SMILES representation of Hydroxy Torsemide is CC(C)NC(=O)NS(=O)(=O)C1=C(C=CN=C1)NC2=CC=CC(=C2)CO.
What is the CAS number of Hydroxy Torsemide?
The CAS number of Hydroxy Torsemide is 99300-68-2.
What is the InChIKey of Hydroxy Torsemide?
The InChIKey of Hydroxy Torsemide is WCYVLAMJCQZUCR-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Hydroxy Torsemide have?
Hydroxy Torsemide has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Hydroxy Torsemide have?
Hydroxy Torsemide has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Hydroxy Torsemide?
The topological polar surface area of Hydroxy Torsemide is 129 Ų.
How many rotatable bond counts does Hydroxy Torsemide have?
Hydroxy Torsemide has 6 rotatable bond counts.
Download
