What is the molecular formula of H-Thr-Val-OH?
The molecular formula of H-Thr-Val-OH is C9H18N2O4.
What is the molecular weight of H-Thr-Val-OH?
The molecular weight of H-Thr-Val-OH is 218.25 g/mol.
How is H-Thr-Val-OH obtained?
H-Thr-Val-OH is obtained by formal condensation of the carboxy group of L-threonine with the amino group of L-valine.
What is the IUPAC name of H-Thr-Val-OH?
The IUPAC name of H-Thr-Val-OH is (2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-methylbutanoic acid.
What is the InChI of H-Thr-Val-OH?
The InChI of H-Thr-Val-OH is InChI=1S/C9H18N2O4/c1-4(2)7(9(14)15)11-8(13)6(10)5(3)12/h4-7,12H,10H2,1-3H3,(H,11,13)(H,14,15)/t5-,6+,7+/m1/s1.
What is the InChIKey of H-Thr-Val-OH?
The InChIKey of H-Thr-Val-OH is CKHWEVXPLJBEOZ-VQVTYTSYSA-N.
What is the canonical SMILES of H-Thr-Val-OH?
The canonical SMILES of H-Thr-Val-OH is CC(C)C(C(=O)O)NC(=O)C(C(C)O)N.
What is the XLogP3 value of H-Thr-Val-OH?
The XLogP3 value of H-Thr-Val-OH is -3.
How many hydrogen bond donor counts does H-Thr-Val-OH have?
H-Thr-Val-OH has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does H-Thr-Val-OH have?
H-Thr-Val-OH has 5 hydrogen bond acceptor counts.