What is the molecular formula of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The molecular formula is C5H7N3O2.
What is the molecular weight of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The molecular weight is 141.13 g/mol.
What is the IUPAC name of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The IUPAC name is 5-amino-4-hydroxy-2-methyl-1H-pyrimidin-6-one.
What is the InChI code of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The InChI code is InChI=1S/C5H7N3O2/c1-2-7-4(9)3(6)5(10)8-2/h6H2,1H3,(H2,7,8,9,10).
What is the InChIKey of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The InChIKey is YICLTNFWMVEECR-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl have?
It has 3 hydrogen bond donor counts.
What is the XLogP3-AA value of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The XLogP3-AA value is -1.3.
How many hydrogen bond acceptor counts does 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl?
The topological polar surface area is 87.7 ².
Is 4(3H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl a canonicalized compound?
Yes, it is a canonicalized compound.