What is the PubChem CID of the compound?
PubChem CID: 6950529
What is the molecular formula of the compound?
Molecular Formula: C19H18N2O3
What are the synonyms of the compound?
Synonyms: H-Phe-AMC, 98516-72-4, (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide, L-Phe-AMC, SCHEMBL3992539
What is the molecular weight of the compound?
Molecular Weight: 322.4 g/mol
What is the IUPAC name of the compound?
IUPAC Name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-phenylpropanamide
What is the InChI of the compound?
InChI: InChI=1S/C19H18N2O3/c1-12-9-18(22)24-17-11-14(7-8-15(12)17)21-19(23)16(20)10-13-5-3-2-4-6-13/h2-9,11,16H,10,20H2,1H3,(H,21,23)/t16-/m0/s1
What is the InChIKey of the compound?
InChIKey: UNWTXWNBQNGDDS-INIZCTEOSA-N
What is the canonical SMILES of the compound?
Canonical SMILES: CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CC3=CC=CC=C3)N
What is the isomeric SMILES of the compound?
Isomeric SMILES: CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CC3=CC=CC=C3)N
Is the compound canonicalized?
Compound Is Canonicalized: Yes