What is the molecular formula of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The molecular formula is C8H9Cl2NO2S.
What is the molecular weight of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The molecular weight is 254.13 g/mol.
What is the IUPAC name of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The IUPAC name is 2,4-dichloro-N,N-dimethylbenzenesulfonamide.
What is the InChI of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The InChI is InChI=1S/C8H9Cl2NO2S/c1-11(2)14(12,13)8-4-3-6(9)5-7(8)10/h3-5H,1-2H3.
What is the InChIKey of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The InChIKey is WFOMHZJRACJGEK-UHFFFAOYSA-N.
What is the Canonical SMILES of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The Canonical SMILES is CN(C)S(=O)(=O)C1=C(C=C(C=C1)Cl)Cl.
What is the CAS number of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The CAS number is 98491-03-3.
What is the hydrogen bond donor count of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The hydrogen bond donor count is 0.
What is the topological polar surface area of 2,4-dichloro-N,N-dimethylbenzenesulfonamide?
The topological polar surface area is 45.8 Å2.
Is the compound canonicalized?
Yes, the compound is canonicalized.