What is the molecular formula of Valclavam?
The molecular formula of Valclavam is C14H23N3O6.
When was Valclavam created and last modified?
Valclavam was created on June 24, 2005, and last modified on December 30, 2023.
What is a synonym for Valclavam?
A synonym for Valclavam is CHEBI:9920.
Is Valclavam a peptide or a carbohydrate?
Valclavam is a peptide.
What is the molecular weight of Valclavam?
The molecular weight of Valclavam is 329.35 g/mol.
What is the Canonical SMILES for Valclavam?
The Canonical SMILES for Valclavam is CC(C)C(C(=O)NC(C(CC1CN2C(O1)CC2=O)O)C(=O)O)N.
How many hydrogen bond donor counts does Valclavam have?
Valclavam has 4 hydrogen bond donor counts.
What is the value of XLogP3-AA for Valclavam?
The value of XLogP3-AA for Valclavam is -3.9.
What is the topological polar surface area of Valclavam?
The topological polar surface area of Valclavam is 142?2.
Is Valclavam considered the canonicalized compound?
Yes, Valclavam is considered the canonicalized compound.