What is the molecular formula of L-Arginine mono[4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-alpha-methylbenzeneacetate]?
The molecular formula is C23H29N5O5.
What are the synonyms for L-Arginine mono[4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-alpha-methylbenzeneacetate] listed in the reference?
The synonyms listed are EINECS 308-473-8, 98072-23-2, and DTXSID50243425.
What is the molecular weight of L-Arginine mono[4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-alpha-methylbenzeneacetate]?
The molecular weight is 455.5 g/mol.
What are the component compounds of L-Arginine mono[4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-alpha-methylbenzeneacetate]?
The component compounds are Arginine and Indoprofen.
When was L-Arginine mono[4-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)-alpha-methylbenzeneacetate] created and last modified?
It was created on 2009-08-20 and last modified on 2023-12-30.
What is the IUPAC name of L-Arginine?
The IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-[4-(3-oxo-1H-isoindol-2-yl)phenyl]propanoic acid.
What is the InChIKey of L-Arginine?
The InChIKey is YFPJISRTMKXOTD-VWMHFEHESA-N.
What is the canonical SMILES of L-Arginine?
The canonical SMILES is CC(C1=CC=C(C=C1)N2CC3=CC=CC=C3C2=O)C(=O)O.C(CC(C(=O)O)N)CN=C(N)N.
What is the European Community (EC) Number of L-Arginine listed in the reference?
The EC Number is 308-473-8.
What is the hydrogen bond donor count and acceptor count of L-Arginine?
The hydrogen bond donor count is 5, and the hydrogen bond acceptor count is 7.