CAS
98027-17-9 Purity
---
98027-17-9 Purity
---
Shopping basket
2-chloro-5-nitro-4-thiocyanatopyrimidine
CAS
98027-74-8
Catalog Number
ACM98027748
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The molecular formula of 2-chloro-5-nitro-4-thiocyanatopyrimidine is C5HClN4O2S.
What is the molecular weight of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The molecular weight of 2-chloro-5-nitro-4-thiocyanatopyrimidine is 216.61 g/mol.
What is the IUPAC name of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The IUPAC name of 2-chloro-5-nitro-4-thiocyanatopyrimidine is (2-chloro-5-nitropyrimidin-4-yl) thiocyanate.
What is the InChI of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The InChI of 2-chloro-5-nitro-4-thiocyanatopyrimidine is InChI=1S/C5HClN4O2S/c6-5-8-1-3(10(11)12)4(9-5)13-2-7/h1H.
What is the InChIKey of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The InChIKey of 2-chloro-5-nitro-4-thiocyanatopyrimidine is GVMBHKFNIKBISV-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-chloro-5-nitro-4-thiocyanatopyrimidine have?
2-chloro-5-nitro-4-thiocyanatopyrimidine does not have any hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-chloro-5-nitro-4-thiocyanatopyrimidine have?
2-chloro-5-nitro-4-thiocyanatopyrimidine has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-chloro-5-nitro-4-thiocyanatopyrimidine?
The topological polar surface area of 2-chloro-5-nitro-4-thiocyanatopyrimidine is 121.2.
How many rotatable bond counts does 2-chloro-5-nitro-4-thiocyanatopyrimidine have?
2-chloro-5-nitro-4-thiocyanatopyrimidine has 1 rotatable bond count.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
