What is the molecular weight of 2-Piperazinecarboxylicacid,3,6-dioxo?
The molecular weight is 158.11 g/mol.
What is the IUPAC name of 2-Piperazinecarboxylicacid,3,6-dioxo?
The IUPAC name is 3,6-dioxopiperazine-2-carboxylic acid.
What is the InChI of 2-Piperazinecarboxylicacid,3,6-dioxo?
The InChI is InChI=1S/C5H6N2O4/c8-2-1-6-4(9)3(7-2)5(10)11/h3H,1H2,(H,6,9)(H,7,8)(H,10,11).
What is the InChIKey of 2-Piperazinecarboxylicacid,3,6-dioxo?
The InChIKey is CPCFVPKLPLOBDR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Piperazinecarboxylicacid,3,6-dioxo?
The canonical SMILES is C1C(=O)NC(C(=O)N1)C(=O)O.
What is the CAS number of 2-Piperazinecarboxylicacid,3,6-dioxo?
The CAS number is 98021-27-3.
What is the XLogP3-AA value of 2-Piperazinecarboxylicacid,3,6-dioxo?
The XLogP3-AA value is -1.
How many hydrogen bond donor counts does 2-Piperazinecarboxylicacid,3,6-dioxo have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Piperazinecarboxylicacid,3,6-dioxo have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-Piperazinecarboxylicacid,3,6-dioxo?
The topological polar surface area is 95.5?^2.