What is the molecular formula of Carbazole (ring-d8)?
The molecular formula of Carbazole (ring-d8) is C12H9N.
What is the molecular weight of Carbazole (ring-d8)?
The molecular weight of Carbazole (ring-d8) is 175.25 g/mol.
What is the IUPAC name of Carbazole (ring-d8)?
The IUPAC name of Carbazole (ring-d8) is 1,2,3,4,5,6,7,8-octadeuterio-9H-carbazole.
What is the InChI of Carbazole (ring-d8)?
The InChI of Carbazole (ring-d8) is InChI=1S/C12H9N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8,13H/i1D,2D,3D,4D,5D,6D,7D,8D.
What is the InChIKey of Carbazole (ring-d8)?
The InChIKey of Carbazole (ring-d8) is UJOBWOGCFQCDNV-PGRXLJNUSA-N.
What is the canonical SMILES of Carbazole (ring-d8)?
The canonical SMILES of Carbazole (ring-d8) is C1=CC=C2C(=C1)C3=CC=CC=C3N2.
What is the XLogP3 value of Carbazole (ring-d8)?
The XLogP3 value of Carbazole (ring-d8) is 3.7.
How many hydrogen bond donor counts does Carbazole (ring-d8) have?
Carbazole (ring-d8) has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Carbazole (ring-d8) have?
Carbazole (ring-d8) has 0 hydrogen bond acceptor count.
How many rotatable bond counts does Carbazole (ring-d8) have?
Carbazole (ring-d8) has 0 rotatable bond count.
What is the topological polar surface area of carbazole (ring-d8)?
The topological polar surface area is 15.8?2.