What is the molecular formula of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The molecular formula is C10H18O.
What is the molecular weight of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The molecular weight is 154.25 g/mol.
What is the IUPAC name of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The IUPAC name is (2S,3E)-3,7-dimethylocta-3,6-dien-2-ol.
What is the InChI of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The InChI is InChI=1S/C10H18O/c1-8(2)6-5-7-9(3)10(4)11/h6-7,10-11H,5H2,1-4H3/b9-7+/t10-/m0/s1.
What is the InChIKey of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The InChIKey is RJSWINAXCPBTMV-PCYYEKQGSA-N.
What is the canonical SMILES of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The canonical SMILES is CC(C(=CCC=C(C)C)C)O.
What is the isomeric SMILES of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The isomeric SMILES is C[C@@H](/C(=C/CC=C(C)C)/C)O.
What is the CAS number of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The CAS number is 97890-07-8.
What is the European Community (EC) number of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The European Community (EC) number is 308-186-8.
What is the XLogP3-AA value of [s-(E)]-3,7-Dimethyl-3,6-octadien-2-ol?
The XLogP3-AA value is 3.