What is the molecular formula of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The molecular formula is C10H18O.
What is the molecular weight of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The molecular weight is 154.25 g/mol.
What is the IUPAC name of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The IUPAC name is (2R,3E)-3,7-dimethylocta-3,6-dien-2-ol.
What is the InChI of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The InChI is InChI=1S/C10H18O/c1-8(2)6-5-7-9(3)10(4)11/h6-7,10-11H,5H2,1-4H3/b9-7+/t10-/m1/s1.
What is the InChIKey of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The InChIKey is RJSWINAXCPBTMV-TTZKWOQHSA-N.
What is the canonical SMILES of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The canonical SMILES is CC(C(=CCC=C(C)C)C)O.
How many hydrogen bond donor counts does [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol?
The topological polar surface area is 20.2 ?2.
How many rotatable bond counts does [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol have?
It has 3 rotatable bond counts.
Is [R-(E)]-3,7-dimethyl-3,6-octadien-2-ol a covalently-bonded unit?
Yes, it is a covalently-bonded unit.