The molecular formula of the compound is C24H23ClO.
What is the molecular weight of the compound?
The molecular weight of the compound is 362.9 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-(2-chloroethoxy)-4-[(Z)-1,2-diphenylbut-1-enyl]benzene.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C24H23ClO/c1-2-23(19-9-5-3-6-10-19)24(20-11-7-4-8-12-20)21-13-15-22(16-14-21)26-18-17-25/h3-16H,2,17-18H2,1H3/b24-23-.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCCl)C3=CC=CC=C3.
What is the CAS number of the compound?
The CAS number of the compound is 97818-83-2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 7.7.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 7 rotatable bond counts.
How many defined bond stereocenter counts does the compound have?
The compound has 1 defined bond stereocenter count.
※ Please kindly note that our products are for research use only.
Download
![Thiazolo[5,4-c]pyridin-2-amine,4,5,6,7-tetrahydro-](https://resource.alfa-chemistry.com/structure/97817-23-7.gif)
