What is the molecular formula of Dibenzylfluorescein?
The molecular formula of Dibenzylfluorescein is C34H24O5.
What is the molecular weight of Dibenzylfluorescein?
The molecular weight of Dibenzylfluorescein is 512.5 g/mol.
What are some synonyms for Dibenzylfluorescein?
Some synonyms for Dibenzylfluorescein are O-Benzylfluorescein, benzyl ester 97744-44-0, and NSC645658.
What is the IUPAC name of Dibenzylfluorescein?
The IUPAC name of Dibenzylfluorescein is benzyl 2-(3-oxo-6-phenylmethoxyxanthen-9-yl)benzoate.
What is the InChIKey of Dibenzylfluorescein?
The InChIKey of Dibenzylfluorescein is YZJGKSLPSGPFEV-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Dibenzylfluorescein?
The Canonical SMILES representation of Dibenzylfluorescein is C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=C4C=CC(=O)C=C4O3)C5=CC=CC=C5C(=O)OCC6=CC=CC=C6.
What is the CAS number of Dibenzylfluorescein?
The CAS number of Dibenzylfluorescein is 97744-44-0.
What is the XLogP3-AA value of Dibenzylfluorescein?
The XLogP3-AA value of Dibenzylfluorescein is 6.1.
How many hydrogen bond acceptor counts does Dibenzylfluorescein have?
Dibenzylfluorescein has 5 hydrogen bond acceptor counts.
Is the compound of Dibenzylfluorescein canonicalized?
Yes, the compound of Dibenzylfluorescein is canonicalized.
Download
![11-Oxa-2,4,9-triazatridecanoicacid,8-carboxy-4-[(1,1-dimethylethoxy)carbonyl]-3-imino-12,12-dimethyl-10-oxo-,1-(1,1-dimethylethyl)ester,(8S)-](https://resource.alfa-chemistry.com/structure/97745-69-2.gif)
