What is the molecular formula of Sorbitan monoisohexadecanoate?
The molecular formula of Sorbitan monoisohexadecanoate is C22H42O6.
What is the molecular weight of Sorbitan monoisohexadecanoate?
The molecular weight of Sorbitan monoisohexadecanoate is 402.6 g/mol.
What is the IUPAC name of Sorbitan monoisohexadecanoate?
The IUPAC name of Sorbitan monoisohexadecanoate is [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] 14-methylpentadecanoate.
What is the InChI of Sorbitan monoisohexadecanoate?
The InChI of Sorbitan monoisohexadecanoate is InChI=1S/C22H42O6/c1-17(2)13-11-9-7-5-3-4-6-8-10-12-14-20(25)28-19(15-23)22-21(26)18(24)16-27-22/h17-19,21-24,26H,3-16H2,1-2H3/t18-,19+,21+,22+/m0/s1.
What is the InChIKey of Sorbitan monoisohexadecanoate?
The InChIKey of Sorbitan monoisohexadecanoate is IFBVBIINWZIPMK-YVNJGZBMSA-N.
What is the canonical SMILES of Sorbitan monoisohexadecanoate?
The canonical SMILES of Sorbitan monoisohexadecanoate is CC(C)CCCCCCCCCCCCC(=O)OC(CO)C1C(C(CO1)O)O.
What is the isomeric SMILES of Sorbitan monoisohexadecanoate?
The isomeric SMILES of Sorbitan monoisohexadecanoate is CC(C)CCCCCCCCCCCCC(=O)O[C@H](CO)[C@@H]1[C@@H]([C@H](CO1)O)O.
What is the XLogP3-AA value of Sorbitan monoisohexadecanoate?
The XLogP3-AA value of Sorbitan monoisohexadecanoate is 5.
How many hydrogen bond donor counts does Sorbitan monoisohexadecanoate have?
Sorbitan monoisohexadecanoate has 3 hydrogen bond donor counts.
How many rotatable bond counts does Sorbitan monoisohexadecanoate have?
Sorbitan monoisohexadecanoate has 17 rotatable bond counts.
※ Please kindly note that our products are for research use only.