What is the molecular formula of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The molecular formula of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is C19H33O4P.
What is the molecular weight of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The molecular weight of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is 356.4 g/mol.
What is the IUPAC name of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The IUPAC name of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is 2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol.
What is the InChI of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The InChI of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is InChI=1S/C19H33O4P/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8/h11-12,20H,9-10,13H2,1-8H3.
What is the InChIKey of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The InChIKey of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is GJDRKHHGPHLVNI-UHFFFAOYSA-N.
What is the canonical SMILES of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The canonical SMILES of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is CCOP(=O)(CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)OCC.
What is the CAS number of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The CAS number of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is 976-56-7.
What is the XLogP3-AA value of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The XLogP3-AA value of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is 4.7.
What is the hydrogen bond donor count of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate?
The hydrogen bond donor count of Diethyl 3,5-di-tert-butyl-4-hydroxybenzyl phosphate is 1.
※ Please kindly note that our products are for research use only.
Download
![4-Amino-N-[3,5-bis(trifluoromethyl)phenyl]benzamide](https://resource.alfa-chemistry.com/structure/976-50-1.gif)
![N-[(8-Ethoxyquinolin-5-yl)sulfonyl]decanamide](https://resource.alfa-chemistry.com/structure/97658-06-5.gif)
![Sodium[5-[(1,2-dihydro-4-hydroxy-2-oxo-3-quinolyl)azo]-4-hydroxybenzene-1,3-disulfonato(4-)]chromate(1-)](https://resource.alfa-chemistry.com/structure/97659-24-0.gif)
