What is the molecular formula of N-Xylylstearamide?
The molecular formula of N-Xylylstearamide is C26H45NO.
What is the molecular weight of N-Xylylstearamide?
The molecular weight of N-Xylylstearamide is 387.6 g/mol.
What is the IUPAC name of N-Xylylstearamide?
The IUPAC name of N-Xylylstearamide is N-(2,4-dimethylphenyl)octadecanamide.
What is the InChI of N-Xylylstearamide?
The InChI of N-Xylylstearamide is InChI=1S/C26H45NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(28)27-25-21-20-23(2)22-24(25)3/h20-22H,4-19H2,1-3H3,(H,27,28).
What is the InChIKey of N-Xylylstearamide?
The InChIKey of N-Xylylstearamide is GBRHGXTWPRAKLE-UHFFFAOYSA-N.
What is the Canonical SMILES of N-Xylylstearamide?
The Canonical SMILES of N-Xylylstearamide is CCCCCCCCCCCCCCCCCC(=O)NC1=C(C=C(C=C1)C).
What is the CAS number of N-Xylylstearamide?
The CAS number of N-Xylylstearamide is 97552-86-8.
What is the XLogP3 value of N-Xylylstearamide?
The XLogP3 value of N-Xylylstearamide is 9.9.
How many rotatable bonds does N-Xylylstearamide have?
N-Xylylstearamide has 17 rotatable bonds.
Is N-Xylylstearamide a covalently-bonded unit?
Yes, N-Xylylstearamide is a covalently-bonded unit.