What is the molecular formula of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The molecular formula is C16H15ClN2O2.
What is the molecular weight of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The molecular weight is 302.75 g/mol.
What is the IUPAC Name of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The IUPAC Name is 1-(2-aminoethylamino)anthracene-9,10-dione;hydrochloride.
What is the InChIKey of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The InChIKey is WYTHYWAAQAHLGD-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The Canonical SMILES is C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)NCCN.Cl.
What is the CAS number of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The CAS number is 97404-13-2.
How many hydrogen bond donor counts are there in 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
There are 3 hydrogen bond donor counts.
What is the exact mass of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The exact mass is 302.0822054 g/mol.
What is the topological polar surface area of 1-[(2-Aminoethyl)amino]anthraquinone, monohydrochloride?
The topological polar surface area is 72.2?2.
Is the compound canonicalized?
Yes, the compound is canonicalized.