What is the PubChem CID of Leguminal?
The PubChem CID of Leguminal is 6366609.
What is the molecular formula of Leguminal?
The molecular formula of Leguminal is C10H20O2.
What is the molecular weight of Leguminal?
The molecular weight of Leguminal is 172.26 g/mol.
What is the IUPAC name of Leguminal?
The IUPAC name of Leguminal is (E)-1-(1-methoxypropoxy)hex-3-ene.
What is the InChI of Leguminal?
The InChI of Leguminal is InChI=1S/C10H20O2/c1-4-6-7-8-9-12-10(5-2)11-3/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+.
What is the InChIKey of Leguminal?
The InChIKey of Leguminal is LDUYDLGCMTVIIO-VOTSOKGWSA-N.
What are the synonyms of Leguminal?
The synonyms of Leguminal include (E)-1-(1-Methoxypropoxy)hex-3-ene, 97358-54-8, and Leguminal 3-Hexene, 1-(1-methoxypropoxy)-, (3E)-.
What is the CAS number of Leguminal?
The CAS number of Leguminal is 97358-54-8.
What is the European Community (EC) number of Leguminal?
The European Community (EC) number of Leguminal is 306-628-4.
Is Leguminal a covalently-bonded unit?
Yes, Leguminal is a covalently-bonded unit.