What is the molecular formula of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The molecular formula is C3H8N4O5S.
When was 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate created and last modified?
It was created on 2005-03-26 and last modified on 2023-12-30.
What are some synonyms for 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
Some synonyms include 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulphate, 97358-51-5, 3,4-DIAMINO-5-HYDROXYPYRAZOLE SULFATE, NSC90286, and EINECS 306-626-3.
What is the molecular weight of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The molecular weight is 212.19 g/mol.
What are the component compounds of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The component compounds are CID 259751 (4,5-Diamino-1,2-dihydro-3H-pyrazol-3-one) and CID 1118 (Sulfuric Acid).
What is the IUPAC name of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The IUPAC name is 4,5-diamino-1,2-dihydropyrazol-3-one;sulfuric acid.
What is the InChIKey of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The InChIKey is PQWHYMIYFPATGG-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate?
The Canonical SMILES representation is C1(=C(NNC1=O)N)N.OS(=O)(=O)O.
How many hydrogen bond donor counts does 4,5-Diamino-1,2-dihydro-3-oxopyrazole sulfate have?
It has 6 hydrogen bond donor counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.