What is the molecular formula of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The molecular formula is C62H115NO8.
What is the molecular weight of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The molecular weight is 1002.6 g/mol.
When was Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate created in PubChem?
It was created on August 20, 2009.
What is the IUPAC name of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The IUPAC name is acetic acid;2-[bis[2-[(E)-octadec-9-enoyl]oxyethyl]amino]ethyl (E)-octadec-9-enoate.
What is the InChI representation of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The InChI is InChI=1S/C60H111NO6.C2H4O2/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-58(62)65-55-52-61(53-56-66-59(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)54-57-67-60(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3;1-2(3)4/h25-30H,4-24,31-57H2,1-3H3;1H3,(H,3,4)/b28-25+,29-26+,30-27+;.
What is the CAS number of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The CAS number is 97337-94-5.
How many hydrogen bond donor counts does Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate have?
It has 1 hydrogen bond donor count.
What is the exact mass of Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate?
The exact mass is 1001.86226963 g/mol.
How many rotatable bond counts does Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate have?
It has 57 rotatable bond counts.
How many defined bond stereocenter counts does Tris[2-(octadec-9-enoyloxy)ethyl]ammonium acetate have?
It has 3 defined bond stereocenter counts.
※ Please kindly note that our products are for research use only.