What is the molecular formula of H-Arg-leu-oh acetate salt?
The molecular formula is C14H29N5O5.
What is the molecular weight of H-Arg-leu-oh acetate salt?
The molecular weight is 347.41 g/mol.
What is the IUPAC name of H-Arg-leu-oh acetate salt?
The IUPAC name is acetic acid;(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoic acid.
What is the InChI of H-Arg-leu-oh acetate salt?
The InChI is InChI=1S/C12H25N5O3.C2H4O2/c1-7(2)6-9(11(19)20)17-10(18)8(13)4-3-5-16-12(14)15;1-2(3)4/h7-9H,3-6,13H2,1-2H3,(H,17,18)(H,19,20)(H4,14,15,16);1H3,(H,3,4)/t8-,9-;/m0./s1
What is the InChIKey of H-Arg-leu-oh acetate salt?
The InChIKey is NETLCCJRXLZURZ-OZZZDHQUSA-N.
What is the Canonical SMILES of H-Arg-leu-oh acetate salt?
The Canonical SMILES is CC(C)CC(C(=O)O)NC(=O)C(CCCN=C(N)N)N.CC(=O)O.
What is the Isomeric SMILES of H-Arg-leu-oh acetate salt?
The Isomeric SMILES is CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CCCN=C(N)N)N.CC(=O)O.
What is the hydrogen bond donor count of H-Arg-leu-oh acetate salt?
The hydrogen bond donor count is 6.
What is the hydrogen bond acceptor count of H-Arg-leu-oh acetate salt?
The hydrogen bond acceptor count is 7.
What is the rotatable bond count of H-Arg-leu-oh acetate salt?
The rotatable bond count is 9.
※ Please kindly note that our products are for research use only.