What is the molecular formula of Deiphenidol hydrochloride?
The molecular formula of Deiphenidol hydrochloride is C21H27NO.
What is the molecular weight of Deiphenidol hydrochloride?
The molecular weight of Deiphenidol hydrochloride is 309.4 g/mol.
What are some synonyms for Deiphenidol hydrochloride?
Some synonyms for Deiphenidol hydrochloride include DIPHENIDOL, Difenidol, and Vontrol.
What is the role of Deiphenidol hydrochloride?
Deiphenidol hydrochloride has a role as an antiemetic.
What is the IUPAC Name of Deiphenidol hydrochloride?
The IUPAC Name of Deiphenidol hydrochloride is 1,1-diphenyl-4-piperidin-1-ylbutan-1-ol.
What are the InChI and InChIKey of Deiphenidol hydrochloride?
The InChI of Deiphenidol hydrochloride is InChI=1S/C21H27NO/c23-21(19-11-4-1-5-12-19,20-13-6-2-7-14-20)15-10-18-22-16-8-3-9-17-22/h1-2,4-7,11-14,23H,3,8-10,15-18H2 and the InChIKey is OGAKLTJNUQRZJU-UHFFFAOYSA-N.
What is the Canonical SMILES of Deiphenidol hydrochloride?
The Canonical SMILES of Deiphenidol hydrochloride is C1CCN(CC1)CCCC(C2=CC=CC=C2)(C3=CC=CC=C3)O.
What is the CAS number of Deiphenidol hydrochloride?
The CAS number of Deiphenidol hydrochloride is 972-02-1.
What is the XLogP3-AA value of Deiphenidol hydrochloride?
The XLogP3-AA value of Deiphenidol hydrochloride is 4.2.
How many hydrogen bond donor count and acceptor count does Deiphenidol hydrochloride have?
Deiphenidol hydrochloride has 1 hydrogen bond donor count and 2 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.