What is the molecular formula of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)-(9ci)?
The molecular formula is C8H11NO.
When was Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)-(9ci) created and modified?
It was created on 2007-02-08 and modified on 2023-12-30.
What is the IUPAC name of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The IUPAC name is 1-(3-ethyl-1H-pyrrol-2-yl)ethanone.
What is the InChI of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The InChI is InChI=1S/C8H11NO/c1-3-7-4-5-9-8(7)6(2)10/h4-5,9H,3H2,1-2H3.
What is the InChIKey of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The InChIKey is RFPLKKYZQFEKCR-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The Canonical SMILES is CCC1=C(NC=C1)C(=O)C.
What is the molecular weight of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The molecular weight is 137.18 g/mol.
How many hydrogen bond donor counts does Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl) have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
The topological polar surface area is 32.9 Ų.
Is the compound canonicalized for Ethanone, 1-(3-ethyl-1H-pyrrol-2-yl)?
Yes, the compound is canonicalized.