What is the molecular formula of Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The molecular formula is C14H23NaO7S.
What is the molecular weight of Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The molecular weight is 358.38 g/mol.
What is the IUPAC name of Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The IUPAC name is sodium; 1-cyclohexyloxy-4-(2-methylpropoxy)-1,4-dioxobutane-2-sulfonate.
What is the InChI code for Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The InChI code is InChI=1S/C14H24O7S.Na/c1-10(2)9-20-13(15)8-12(22(17,18)19)14(16)21-11-6-4-3-5-7-11;/h10-12H,3-9H2,1-2H3,(H,17,18,19);/q;+1/p-1.
What is the Canonical SMILES representation of Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The Canonical SMILES representation is CC(C)COC(=O)CC(C(=O)OC1CCCCC1)S(=O)(=O)[O-].[Na+].
What is the CAS number for Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The CAS number is 97158-41-3.
How many hydrogen bond donor counts are there in Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
There are 7 hydrogen bond acceptor counts.
What is the topological polar surface area of Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
The topological polar surface area is 118 Ų.
Is the compound canonicalized for Sodium 1-cyclohexyl 4-(2-methylpropyl)sulfonatosuccinate?
Yes, the compound is canonicalized.