What is the molecular formula of N-methyl-N-(1-oxododecyl)-glycine?
The molecular formula is C15H29NO3.
What is the molecular weight of N-methyl-N-(1-oxododecyl)-glycine?
The molecular weight is 271.40 g/mol.
What are the synonyms for N-methyl-N-(1-oxododecyl)-glycine?
The synonyms are N-LAUROYLSARCOSINE, Lauroyl sarcosine, and Glycine, N-methyl-N-(1-oxododecyl)-.
What type of compound is N-methyl-N-(1-oxododecyl)-glycine?
It is an N-acyl-amino acid.
What are the uses of acyl sarcosines and their sodium salts?
They are used as hair-conditioning agents and surfactant-cleansing agents in cosmetics, as well as to improve wetting and penetration of topical pharmaceutical products. They are also used in the metal finishing and processing industries for their crystal modifying, anti-rust, and anti-corrosion properties.
What is the IUPAC name of N-methyl-N-(1-oxododecyl)-glycine?
The IUPAC name is 2-[dodecanoyl(methyl)amino]acetic acid.
What is the InChI of N-methyl-N-(1-oxododecyl)-glycine?
The InChI is InChI=1S/C15H29NO3/c1-3-4-5-6-7-8-9-10-11-12-14(17)16(2)13-15(18)19/h3-13H2,1-2H3,(H,18,19).
What is the InChIKey of N-methyl-N-(1-oxododecyl)-glycine?
The InChIKey is BACYUWVYYTXETD-UHFFFAOYSA-N.
What is the CAS number of N-methyl-N-(1-oxododecyl)-glycine?
The CAS number is 97-78-9.
What is the molecular weight of N-methyl-N-(1-oxododecyl)-glycine according to PubChem?
The molecular weight is 271.40 g/mol, computed by PubChem 2.2.
※ Please kindly note that our products are for research use only.
Download
![L-Leucinamide,N-[(phenylmethoxy)carbonyl]glycylglycyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-](https://resource.alfa-chemistry.com/structure/97792-39-7.gif)
![Quinolinium,1-ethyl-2-[(1-ethyl-2(1H)-quinolinylidene)methyl]-,iodide(1:1)](https://resource.alfa-chemistry.com/structure/977-96-8.gif)
