What is the molecular formula of 2-Methylpentanoic acid?
The molecular formula of 2-Methylpentanoic acid is C6H12O2.
What is the molecular weight of 2-Methylpentanoic acid?
The molecular weight of 2-Methylpentanoic acid is 116.16 g/mol.
What is the IUPAC name of 2-Methylpentanoic acid?
The IUPAC name of 2-Methylpentanoic acid is 2-methylpentanoic acid.
What is the InChI of 2-Methylpentanoic acid?
The InChI of 2-Methylpentanoic acid is InChI=1S/C6H12O2/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8).
What is the InChIKey of 2-Methylpentanoic acid?
The InChIKey of 2-Methylpentanoic acid is OVBFMEVBMNZIBR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methylpentanoic acid?
The canonical SMILES of 2-Methylpentanoic acid is CCCC(C)C(=O)O.
What is the CAS number of 2-Methylpentanoic acid?
The CAS number of 2-Methylpentanoic acid is 97-61-0.
What is the FEMA number of 2-Methylpentanoic acid?
The FEMA number of 2-Methylpentanoic acid is 2754.
What is the Lipid Maps ID (LM_ID) of 2-Methylpentanoic acid?
The Lipid Maps ID (LM_ID) of 2-Methylpentanoic acid is LMFA01020074.
What is the XLogP3 value of 2-Methylpentanoic acid?
The XLogP3 value of 2-Methylpentanoic acid is 1.8.