What is the molecular formula of Cyclethrin?
The molecular formula of Cyclethrin is C21H28O3.
What is the molecular weight of Cyclethrin?
The molecular weight of Cyclethrin is 328.4 g/mol.
When was Cyclethrin created?
Cyclethrin was created on August 8, 2005.
When was Cyclethrin last modified?
Cyclethrin was last modified on December 30, 2023.
What is the IUPAC name of Cyclethrin?
The IUPAC name of Cyclethrin is (3-cyclopent-2-en-1-yl-2-methyl-4-oxocyclopent-2-en-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
What is the InChI representation of Cyclethrin?
The InChI representation of Cyclethrin is InChI=1S/C21H28O3/c1-12(2)10-15-19(21(15,4)5)20(23)24-17-11-16(22)18(13(17)3)14-8-6-7-9-14/h6,8,10,14-15,17,19H,7,9,11H2,1-5H3.
What is the InChIKey of Cyclethrin?
The InChIKey of Cyclethrin is YJXNJQHBVKTWCC-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclethrin?
The canonical SMILES of Cyclethrin is CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C).
What is the CAS number of Cyclethrin?
The CAS number of Cyclethrin is 97-11-0.
Is Cyclethrin a covalently-bonded unit?
Yes, Cyclethrin is a covalently-bonded unit.