What is the molecular formula of ethyl phenylcyanoacetate?
The molecular formula of ethyl phenylcyanoacetate is C11H11NO2.
What is the molecular weight of ethyl phenylcyanoacetate?
The molecular weight of ethyl phenylcyanoacetate is 189.21 g/mol.
What is the IUPAC name of ethyl phenylcyanoacetate?
The IUPAC name of ethyl phenylcyanoacetate is ethyl 2-cyano-2-phenylacetate.
What is the InChI of ethyl phenylcyanoacetate?
The InChI of ethyl phenylcyanoacetate is InChI=1S/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3.
What is the InChIKey of ethyl phenylcyanoacetate?
The InChIKey of ethyl phenylcyanoacetate is SXIRJEDGTAKGKU-UHFFFAOYSA-N.
What is the CAS number of ethyl phenylcyanoacetate?
The CAS number of ethyl phenylcyanoacetate is 4553-07-5.
What is the European Community (EC) Number of ethyl phenylcyanoacetate?
The European Community (EC) Number of ethyl phenylcyanoacetate is 224-921-4.
What is the formal charge of ethyl phenylcyanoacetate?
The formal charge of ethyl phenylcyanoacetate is 0.
How many hydrogen bond acceptor count does ethyl phenylcyanoacetate have?
Ethyl phenylcyanoacetate has 3 hydrogen bond acceptor count.
How many rotatable bond count does ethyl phenylcyanoacetate have?
Ethyl phenylcyanoacetate has 4 rotatable bond count.